cas: 915770-01-3 — see every product listed under this CAS number, including other names
(2-(4-(tert-Butoxycarbonyl)piperazin-1-yl)phenyl)boronic acid, 98% (CAS 915770-01-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F464414-100MG |
| cas | 915770-01-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 247.85 Pln | |
| Fluorochem | 1g | 737.26 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
[2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenyl]boronic acid (CAS 915770-01-3) is a chemical compound with the molecular formula C15H23BN2O4 and a molecular weight of 306.17 g/mol. IUPAC name: [2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenyl]boronic acid. InChIKey: CVTSGDSTXRXWPI-UHFFFAOYSA-N.
| Molecular formula | C15H23BN2O4 |
|---|---|
| Molecular weight | 306.17 g/mol |
| IUPAC name | [2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenyl]boronic acid |
| InChIKey | CVTSGDSTXRXWPI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1N2CCN(CC2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)