CAS 457613-78-4 appears in our catalog under these names: 4-(4-BOC-Piperazino)phenylboronic acid, 97%, (4-[4-(tert-Butoxycarbonyl)piperazin-1-yl]phenyl)boronic acid, 95%, (4-[4-(tert-Butoxycarbonyl)piperazin-1-yl]phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g, 25g.
[4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenyl]boronic acid (CAS 457613-78-4) is a chemical compound with the molecular formula C15H23BN2O4 and a molecular weight of 306.17 g/mol. IUPAC name: [4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenyl]boronic acid. InChIKey: BXGOBSWUEXKOIH-UHFFFAOYSA-N.
| Molecular formula | C15H23BN2O4 |
|---|---|
| Molecular weight | 306.17 g/mol |
| IUPAC name | [4-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]phenyl]boronic acid |
| InChIKey | BXGOBSWUEXKOIH-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N2CCN(CC2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)