CAS 1822308-27-9 is the registry number for 2-(tert-Butyloxycarbonyl)pyrimidine-5-boronic acid pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate (CAS 1822308-27-9) is a chemical compound with the molecular formula C15H23BN2O4 and a molecular weight of 306.17 g/mol. IUPAC name: tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate. InChIKey: NWAMCEWEIFZABT-UHFFFAOYSA-N.
| Molecular formula | C15H23BN2O4 |
|---|---|
| Molecular weight | 306.17 g/mol |
| IUPAC name | tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidine-2-carboxylate |
| InChIKey | NWAMCEWEIFZABT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(N=C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)