(2-(Benzyloxy)-3-fluorophenyl)boronic acid, 97%, 97%
cas: 1256355-53-9 — see every product listed under this CAS number, including other names
(2-(Benzyloxy)-3-fluorophenyl)boronic acid, 97%, 97% (CAS 1256355-53-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111O57-100mg |
| cas | 1256355-53-9 |
| size | 100mg |
| availability | 100g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 261.20 Pln | |
| Chemat | 5g | 909.20 Pln | |
| Chemat | 10g | 1710.80 Pln | |
| Chemat | 25g | 3371.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3-fluoro-2-phenylmethoxyphenyl)boronic acid (CAS 1256355-53-9) is a chemical compound with the molecular formula C13H12BFO3 and a molecular weight of 246.04 g/mol. IUPAC name: (3-fluoro-2-phenylmethoxyphenyl)boronic acid. InChIKey: BLCQROGHALPIMD-UHFFFAOYSA-N.
| Molecular formula | C13H12BFO3 |
|---|---|
| Molecular weight | 246.04 g/mol |
| IUPAC name | (3-fluoro-2-phenylmethoxyphenyl)boronic acid |
| InChIKey | BLCQROGHALPIMD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)F)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(2-(Benzyloxy)-3-fluorophenyl)boronic acid, (3-fluoro-2-phenylmethoxyphenyl)boronic acid, Boronic acid, B-[3-fluoro-2-(phenylmethoxy)phenyl]-, (2-Benzyloxy-3-fluoro-phenyl)boronic acid, [2-(Benzyloxy)-3-fluorophenyl]boronic acid, (2-Benzyloxy-3-fluorophenyl)boronic acid, (2-(Benzyloxy)-3-fluorophenyl)boronicacid, (2-(Benzyloxy)-3-fluorophenyl)boronic acid - [B88655]