CAS 1072951-98-4 appears in our catalog under these names: 4-(3'-Fluorobenzyloxy)phenylboronic acid, 98%, 4–(3′–Fluorobenzyloxy)phenylboronic acid, 4-(3'-Fluorobenzyloxy)phenylboronic acid, ≥95%, ≥95%, (4-((3-Fluorobenzyl)oxy)phenyl)boronic acid, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g.
[4-[(3-fluorophenyl)methoxy]phenyl]boronic acid (CAS 1072951-98-4) is a chemical compound with the molecular formula C13H12BFO3 and a molecular weight of 246.04 g/mol. IUPAC name: [4-[(3-fluorophenyl)methoxy]phenyl]boronic acid. InChIKey: HLPBNLKHBWJWNP-UHFFFAOYSA-N.
| Molecular formula | C13H12BFO3 |
|---|---|
| Molecular weight | 246.04 g/mol |
| IUPAC name | [4-[(3-fluorophenyl)methoxy]phenyl]boronic acid |
| InChIKey | HLPBNLKHBWJWNP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2=CC(=CC=C2)F)(O)O |
Computed by PubChem (NCBI)