CAS 1217500-68-9 appears in our catalog under these names: 5-(Benzyloxy)-2-fluorophenylboronic acid, 98%, (5-(Benzyloxy)-2-fluorophenyl)boronic acid, 97%, (5–(Benzyloxy)–2–fluorophenyl)boronic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
(2-fluoro-5-phenylmethoxyphenyl)boronic acid (CAS 1217500-68-9) is a chemical compound with the molecular formula C13H12BFO3 and a molecular weight of 246.04 g/mol. IUPAC name: (2-fluoro-5-phenylmethoxyphenyl)boronic acid. InChIKey: DIHHJULQESBDHE-UHFFFAOYSA-N.
| Molecular formula | C13H12BFO3 |
|---|---|
| Molecular weight | 246.04 g/mol |
| IUPAC name | (2-fluoro-5-phenylmethoxyphenyl)boronic acid |
| InChIKey | DIHHJULQESBDHE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OCC2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)