(2-(Benzyloxy)-6-fluorophenyl)boronic acid, 98%
cas: 1217500-53-2 — see every product listed under this CAS number, including other names
(2-(Benzyloxy)-6-fluorophenyl)boronic acid, 98% (CAS 1217500-53-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A741637-100mg |
| cas | 1217500-53-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 442.69 Pln | |
| Ambeed | 10g | 759.75 Pln | |
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 323.60 Pln | |
| Chemat | 10g | 587.60 Pln | |
| Chemat | 25g | 1370.00 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 181.07 Pln | |
| BLDpharm | 5g | 469.86 Pln | |
| BLDpharm | 10g | 814.18 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2-fluoro-6-phenylmethoxyphenyl)boronic acid (CAS 1217500-53-2) is a chemical compound with the molecular formula C13H12BFO3 and a molecular weight of 246.04 g/mol. IUPAC name: (2-fluoro-6-phenylmethoxyphenyl)boronic acid. InChIKey: NBRVDQVRGXXXIE-UHFFFAOYSA-N.
| Molecular formula | C13H12BFO3 |
|---|---|
| Molecular weight | 246.04 g/mol |
| IUPAC name | (2-fluoro-6-phenylmethoxyphenyl)boronic acid |
| InChIKey | NBRVDQVRGXXXIE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC=C1F)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Benzyloxy-6-fluorophenylboronic acid, (2-(Benzyloxy)-6-fluorophenyl)boronic acid, (2-fluoro-6-phenylmethoxyphenyl)boronic acid, [2-(Benzyloxy)-6-fluorophenyl]boronic acid, 2-(benzyloxy)-6-fluorophenylboronic acid, (2-Benzyloxy-6-fluoro-phenyl)boronic acid, 2-(benz, s11002, (2-(Benzyloxy)-6-fluorophenyl)boronicacid