cas: 1311159-02-0 — see every product listed under this CAS number, including other names
(2-(Cyclopentyloxy)phenyl)boronic acid, 98%, 98% (CAS 1311159-02-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111VJ7-250mg |
| cas | 1311159-02-0 |
| size | 250mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 438.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-cyclopentyloxyphenyl)boronic acid (CAS 1311159-02-0) is a chemical compound with the molecular formula C11H15BO3 and a molecular weight of 206.05 g/mol. IUPAC name: (2-cyclopentyloxyphenyl)boronic acid. InChIKey: WGINBVBPTCTQOQ-UHFFFAOYSA-N.
| Molecular formula | C11H15BO3 |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | (2-cyclopentyloxyphenyl)boronic acid |
| InChIKey | WGINBVBPTCTQOQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1OC2CCCC2)(O)O |
Computed by PubChem (NCBI)