Products 2377607-95-7

CAS 2377607-95-7 is the registry number for 3-(Isopentanoyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

[3-(3-methylbutanoyl)phenyl]boronic acid (CAS 2377607-95-7) is a chemical compound with the molecular formula C11H15BO3 and a molecular weight of 206.05 g/mol. IUPAC name: [3-(3-methylbutanoyl)phenyl]boronic acid. InChIKey: LRVNWWSPVGZJSF-UHFFFAOYSA-N.

Identity
Molecular formulaC11H15BO3
Molecular weight206.05 g/mol
IUPAC name[3-(3-methylbutanoyl)phenyl]boronic acid
InChIKeyLRVNWWSPVGZJSF-UHFFFAOYSA-N
SMILESB(C1=CC(=CC=C1)C(=O)CC(C)C)(O)O

Computed by PubChem (NCBI)