Products 1311183-31-9
CAS 1311183-31-9 appears in our catalog under these names: 2-(cyclopropylmethoxy)-5-methylphenylboronic acid, 95%, (2-(Cyclopropylmethoxy)-5-methylphenyl)boronic acid, 98%, 2-(cyclopropylmethoxy)-5-methylphenylboronic acid, 97%, 97%, 2-(cyclopropylmethoxy)-5-methylphenylboronic acid, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
[2-(cyclopropylmethoxy)-5-methylphenyl]boronic acid (CAS 1311183-31-9) is a chemical compound with the molecular formula C11H15BO3 and a molecular weight of 206.05 g/mol. IUPAC name: [2-(cyclopropylmethoxy)-5-methylphenyl]boronic acid. InChIKey: HDCXPITXWUSFAB-UHFFFAOYSA-N.
| Molecular formula | C11H15BO3 |
|---|---|
| Molecular weight | 206.05 g/mol |
| IUPAC name | [2-(cyclopropylmethoxy)-5-methylphenyl]boronic acid |
| InChIKey | HDCXPITXWUSFAB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C)OCC2CC2)(O)O |
Computed by PubChem (NCBI)