cas: 957121-11-8 — see every product listed under this CAS number, including other names
(2-(Methylthio)-5-(trifluoromethoxy)phenyl)boronic acid, 97% (CAS 957121-11-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A684036-5g |
| cas | 957121-11-8 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7517.44 Pln | |
| AmBeed | 100mg | 766.57 Pln | |
| Fluorochem | 100mg | 529.00 Pln | |
| Fluorochem | 250mg | 581.06 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2-methylsulfanyl-5-(trifluoromethoxy)phenyl]boronic acid (CAS 957121-11-8) is a chemical compound with the molecular formula C8H8BF3O3S and a molecular weight of 252.02 g/mol. IUPAC name: [2-methylsulfanyl-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: RYFVCYILRFDPBU-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O3S |
|---|---|
| Molecular weight | 252.02 g/mol |
| IUPAC name | [2-methylsulfanyl-5-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | RYFVCYILRFDPBU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC(F)(F)F)SC)(O)O |
Computed by PubChem (NCBI)