CAS 1005206-27-8 appears in our catalog under these names: 4-(Methylsulfanyl)-3-(trifluoromethoxy)phenylboronic acid, 98%, 4-(Methylsulfanyl)-3-(trifluoromethoxy)phenylboronic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[4-methylsulfanyl-3-(trifluoromethoxy)phenyl]boronic acid (CAS 1005206-27-8) is a chemical compound with the molecular formula C8H8BF3O3S and a molecular weight of 252.02 g/mol. IUPAC name: [4-methylsulfanyl-3-(trifluoromethoxy)phenyl]boronic acid. InChIKey: KZMPCESUPRQUAO-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O3S |
|---|---|
| Molecular weight | 252.02 g/mol |
| IUPAC name | [4-methylsulfanyl-3-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | KZMPCESUPRQUAO-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)SC)OC(F)(F)F)(O)O |
Computed by PubChem (NCBI)