CAS 957121-11-8 appears in our catalog under these names: 2-Methylthio-5-trifluoromethoxyphenylboronic acid, 97%, (2-(Methylthio)-5-(trifluoromethoxy)phenyl)boronic acid, 97%, (2-(Methylthio)-5-(trifluoromethoxy)phenyl)boronic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
[2-methylsulfanyl-5-(trifluoromethoxy)phenyl]boronic acid (CAS 957121-11-8) is a chemical compound with the molecular formula C8H8BF3O3S and a molecular weight of 252.02 g/mol. IUPAC name: [2-methylsulfanyl-5-(trifluoromethoxy)phenyl]boronic acid. InChIKey: RYFVCYILRFDPBU-UHFFFAOYSA-N.
| Molecular formula | C8H8BF3O3S |
|---|---|
| Molecular weight | 252.02 g/mol |
| IUPAC name | [2-methylsulfanyl-5-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | RYFVCYILRFDPBU-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC(F)(F)F)SC)(O)O |
Computed by PubChem (NCBI)