cas: 1072946-63-4 — see every product listed under this CAS number, including other names
(2-(N-Benzylsulfamoyl)-5-methylphenyl)boronic acid, 97%, 97% (CAS 1072946-63-4) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BK9-5g |
| cas | 1072946-63-4 |
| size | 5g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 2109.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[2-(benzylsulfamoyl)-5-methylphenyl]boronic acid (CAS 1072946-63-4) is a chemical compound with the molecular formula C14H16BNO4S and a molecular weight of 305.2 g/mol. IUPAC name: [2-(benzylsulfamoyl)-5-methylphenyl]boronic acid. InChIKey: HHRKXIUUPXKKLE-UHFFFAOYSA-N.
| Molecular formula | C14H16BNO4S |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | [2-(benzylsulfamoyl)-5-methylphenyl]boronic acid |
| InChIKey | HHRKXIUUPXKKLE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C)S(=O)(=O)NCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)