CAS 871329-73-6 appears in our catalog under these names: N-Benzyl 3-borono-4-methylbenzenesulfonamide, 98%, 5–(N–BENZYLSULFAMOYL)–2–METHYLPHENYLBORONIC ACID. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
[5-(benzylsulfamoyl)-2-methylphenyl]boronic acid (CAS 871329-73-6) is a chemical compound with the molecular formula C14H16BNO4S and a molecular weight of 305.2 g/mol. IUPAC name: [5-(benzylsulfamoyl)-2-methylphenyl]boronic acid. InChIKey: VFDVOIFZPBZUIB-UHFFFAOYSA-N.
| Molecular formula | C14H16BNO4S |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | [5-(benzylsulfamoyl)-2-methylphenyl]boronic acid |
| InChIKey | VFDVOIFZPBZUIB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)S(=O)(=O)NCC2=CC=CC=C2)C)(O)O |
Computed by PubChem (NCBI)