CAS 690662-88-5 appears in our catalog under these names: (4-(N-Phenethylsulfamoyl)phenyl)boronic acid, 95%, 4–(((2–phenylethyl)amino)sulfonyl)phenyl)Boronic acid, (4-(N-Phenethylsulfamoyl)phenyl)boronic acid, 97%, 97%, [4-[[(2-PHENYLETHYL)AMINO]SULFONYL]PHENYL]BORONIC ACID, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
[4-(2-phenylethylsulfamoyl)phenyl]boronic acid (CAS 690662-88-5) is a chemical compound with the molecular formula C14H16BNO4S and a molecular weight of 305.2 g/mol. IUPAC name: [4-(2-phenylethylsulfamoyl)phenyl]boronic acid. InChIKey: JKFNGKMSRZZEGG-UHFFFAOYSA-N.
| Molecular formula | C14H16BNO4S |
|---|---|
| Molecular weight | 305.2 g/mol |
| IUPAC name | [4-(2-phenylethylsulfamoyl)phenyl]boronic acid |
| InChIKey | JKFNGKMSRZZEGG-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)NCCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)