cas: 608515-90-8 — see every product listed under this CAS number, including other names
(2-(Trifluoromethyl)pyrimidin-5-yl)methanol 98% (CAS 608515-90-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A124992-100mg |
| cas | 608515-90-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 987.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A124992 |
Methyl 2-(trifluoromethyl)pyrimidine-5-carboxylate (CAS 608515-90-8) is a chemical compound with the molecular formula C7H5F3N2O2 and a molecular weight of 206.12 g/mol. IUPAC name: methyl 2-(trifluoromethyl)pyrimidine-5-carboxylate. InChIKey: CEPDGVKMMGJWOH-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O2 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | methyl 2-(trifluoromethyl)pyrimidine-5-carboxylate |
| InChIKey | CEPDGVKMMGJWOH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=C(N=C1)C(F)(F)F |
Computed by PubChem (NCBI)