Products 1227489-68-0
CAS 1227489-68-0 appears in our catalog under these names: 2-Amino-4-(trifluoromethyl)nicotinic acid, 95%, 2–Amino–4–(trifluoromethyl)nicotinic acid, 2-Amino-4-(trifluoromethyl)nicotinic acid, 2-Amino-4-(trifluoromethyl)nicotinic acid 95%, 2-Amino-4-(trifluoromethyl)nicotinic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-amino-4-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 1227489-68-0) is a chemical compound with the molecular formula C7H5F3N2O2 and a molecular weight of 206.12 g/mol. IUPAC name: 2-amino-4-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: HLNBKIZJWCGTIO-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O2 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2-amino-4-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | HLNBKIZJWCGTIO-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1C(F)(F)F)C(=O)O)N |
Computed by PubChem (NCBI)