Products 944900-39-4
CAS 944900-39-4 appears in our catalog under these names: 2-Amino-5-(trifluoromethyl)nicotinic acid, 98%, 2-Amino-5-(trifluoromethyl)nicotinic acid, 95+%, 2-Amino-5-(trifluoromethyl)nicotinic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 25g.
2-amino-5-(trifluoromethyl)pyridine-3-carboxylic acid (CAS 944900-39-4) is a chemical compound with the molecular formula C7H5F3N2O2 and a molecular weight of 206.12 g/mol. IUPAC name: 2-amino-5-(trifluoromethyl)pyridine-3-carboxylic acid. InChIKey: KTYDRFWLNANPIH-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O2 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2-amino-5-(trifluoromethyl)pyridine-3-carboxylic acid |
| InChIKey | KTYDRFWLNANPIH-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)N)C(F)(F)F |
Computed by PubChem (NCBI)