cas: 380430-55-7 — see every product listed under this CAS number, including other names
(2-Amino-4-(methoxycarbonyl)phenyl)boronic acid hydrochloride, 98%, 98% (CAS 380430-55-7) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I8HI-50g |
| cas | 380430-55-7 |
| size | 50g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 1922.00 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 323.60 Pln | |
| Chemat | 10g | 544.40 Pln | |
| Chemat | 25g | 1096.40 Pln | |
| Chemat | 100g | 3506.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-amino-4-methoxycarbonylphenyl)boronic acid;hydrochloride (CAS 380430-55-7) is a chemical compound with the molecular formula C8H11BClNO4 and a molecular weight of 231.44 g/mol. IUPAC name: (2-amino-4-methoxycarbonylphenyl)boronic acid;hydrochloride. InChIKey: IDUSDMZTKZZVAW-UHFFFAOYSA-N.
| Molecular formula | C8H11BClNO4 |
|---|---|
| Molecular weight | 231.44 g/mol |
| IUPAC name | (2-amino-4-methoxycarbonylphenyl)boronic acid;hydrochloride |
| InChIKey | IDUSDMZTKZZVAW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OC)N)(O)O.Cl |
Computed by PubChem (NCBI)