cas: 380430-55-7 — see every product listed under this CAS number, including other names
2-Amino-4-(methoxycarbonyl)phenylboronic Acid Hydrochloride (contains varying amounts of Anhydride), >98.0%(HPLC) (CAS 380430-55-7) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A3028-200MG |
| cas | 380430-55-7 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 206.86 Pln | |
| TCI | 1g | 619.90 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC) |
(2-amino-4-methoxycarbonylphenyl)boronic acid;hydrochloride (CAS 380430-55-7) is a chemical compound with the molecular formula C8H11BClNO4 and a molecular weight of 231.44 g/mol. IUPAC name: (2-amino-4-methoxycarbonylphenyl)boronic acid;hydrochloride. InChIKey: IDUSDMZTKZZVAW-UHFFFAOYSA-N.
| Molecular formula | C8H11BClNO4 |
|---|---|
| Molecular weight | 231.44 g/mol |
| IUPAC name | (2-amino-4-methoxycarbonylphenyl)boronic acid;hydrochloride |
| InChIKey | IDUSDMZTKZZVAW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OC)N)(O)O.Cl |
Computed by PubChem (NCBI)