cas: 380430-55-7 — see every product listed under this CAS number, including other names
2-Amino-4-methoxycarbonylphenylboronic acid hydrochloride, 95% (CAS 380430-55-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219363-1G |
| cas | 380430-55-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 508.17 Pln | |
| Fluorochem | 10g | 872.63 Pln | |
| Fluorochem | 25g | 1606.74 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2-amino-4-methoxycarbonylphenyl)boronic acid;hydrochloride (CAS 380430-55-7) is a chemical compound with the molecular formula C8H11BClNO4 and a molecular weight of 231.44 g/mol. IUPAC name: (2-amino-4-methoxycarbonylphenyl)boronic acid;hydrochloride. InChIKey: IDUSDMZTKZZVAW-UHFFFAOYSA-N.
| Molecular formula | C8H11BClNO4 |
|---|---|
| Molecular weight | 231.44 g/mol |
| IUPAC name | (2-amino-4-methoxycarbonylphenyl)boronic acid;hydrochloride |
| InChIKey | IDUSDMZTKZZVAW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OC)N)(O)O.Cl |
Computed by PubChem (NCBI)