cas: 2288710-47-2 — see every product listed under this CAS number, including other names
(2-Amino-5-(3-(piperidin-1-yl)propoxy)phenyl)methanol, 97%, 97% (CAS 2288710-47-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12KKFV-50mg |
| cas | 2288710-47-2 |
| size | 50mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 174.80 Pln | |
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 362.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[2-amino-5-(3-piperidin-1-ylpropoxy)phenyl]methanol (CAS 2288710-47-2) is a chemical compound with the molecular formula C15H24N2O2 and a molecular weight of 264.36 g/mol. IUPAC name: [2-amino-5-(3-piperidin-1-ylpropoxy)phenyl]methanol. InChIKey: IUXSQYNJJDFENB-UHFFFAOYSA-N.
| Molecular formula | C15H24N2O2 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | [2-amino-5-(3-piperidin-1-ylpropoxy)phenyl]methanol |
| InChIKey | IUXSQYNJJDFENB-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)CCCOC2=CC(=C(C=C2)N)CO |
Computed by PubChem (NCBI)