Products 1354652-91-7

CAS 1354652-91-7 is the registry number for 3-(((2-(Diethylamino)ethyl)(methyl)amino)methyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoic acid (CAS 1354652-91-7) is a chemical compound with the molecular formula C15H24N2O2 and a molecular weight of 264.36 g/mol. IUPAC name: 3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoic acid. InChIKey: VTHMKOKMHDLKNR-UHFFFAOYSA-N.

Identity
Molecular formulaC15H24N2O2
Molecular weight264.36 g/mol
IUPAC name3-[[2-(diethylamino)ethyl-methylamino]methyl]benzoic acid
InChIKeyVTHMKOKMHDLKNR-UHFFFAOYSA-N
SMILESCCN(CC)CCN(C)CC1=CC(=CC=C1)C(=O)O

Computed by PubChem (NCBI)