Products 145572-44-7
CAS 145572-44-7 appears in our catalog under these names: Sophocarpine, 95%, Sophocarpine monohydrate, 95%, Sophocarpine monohydrate/ 99.33% (existing batch purity), Sophocarpine monohydrate, Sophocarpine Monohydrate. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, TCI. Available pack sizes: 100mg, 250mg, 50mg, 10mg, 10mM (in 1ml dmso), 5mg, 25mg, 1g.
(1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one;hydrate (CAS 145572-44-7) is a chemical compound with the molecular formula C15H24N2O2 and a molecular weight of 264.36 g/mol. IUPAC name: (1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one;hydrate. InChIKey: FBOREIYHDGYUFA-PUILLJIJSA-N.
| Molecular formula | C15H24N2O2 |
|---|---|
| Molecular weight | 264.36 g/mol |
| IUPAC name | (1R,2R,9S,17S)-7,13-diazatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one;hydrate |
| InChIKey | FBOREIYHDGYUFA-PUILLJIJSA-N |
| SMILES | C1C[C@H]2CN3[C@H](CC=CC3=O)[C@@H]4[C@H]2N(C1)CCC4.O |
Computed by PubChem (NCBI)