cas: 152193-00-5 — see every product listed under this CAS number, including other names
(2-Aminoethyl)-benzyl carbamic acid tert-butylester (CAS 152193-00-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F023486-1G |
| cas | 152193-00-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 560.24 Pln | |
| Fluorochem | 5g | 1570.30 Pln | |
| Fluorochem | 10g | 1695.25 Pln | |
| Fluorochem | 25g | 5360.63 Pln |
| delivery time | 2-3 weeks |
|---|
Tert-butyl N-(2-aminoethyl)-N-benzylcarbamate (CAS 152193-00-5) is a chemical compound with the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. IUPAC name: tert-butyl N-(2-aminoethyl)-N-benzylcarbamate. InChIKey: NFGJZHRLYRSRPU-UHFFFAOYSA-N.
| Molecular formula | C14H22N2O2 |
|---|---|
| Molecular weight | 250.34 g/mol |
| IUPAC name | tert-butyl N-(2-aminoethyl)-N-benzylcarbamate |
| InChIKey | NFGJZHRLYRSRPU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(CCN)CC1=CC=CC=C1 |
Computed by PubChem (NCBI)