CAS 1581-13-1 appears in our catalog under these names: 2-Amino-2'-fluorobenzophenone, >95% (HPLC), (2-Aminophenyl)(2-fluorophenyl)methanone, 95%, 95%, (2-AMINOPHENYL)(2-FLUOROPHENYL)METHANONE. Offered by: TRC, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
(2-aminophenyl)-(2-fluorophenyl)methanone (CAS 1581-13-1) is a chemical compound with the molecular formula C13H10FNO and a molecular weight of 215.22 g/mol. IUPAC name: (2-aminophenyl)-(2-fluorophenyl)methanone. InChIKey: NRAJMXHXQHCBHO-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO |
|---|---|
| Molecular weight | 215.22 g/mol |
| IUPAC name | (2-aminophenyl)-(2-fluorophenyl)methanone |
| InChIKey | NRAJMXHXQHCBHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=CC=C2F)N |
Computed by PubChem (NCBI)