CAS 10055-40-0 appears in our catalog under these names: (4-Aminophenyl)(4-fluorophenyl)methanone, 95%, (4-Aminophenyl)(4-fluorophenyl)methanone. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 25g, 0,5g.
(4-aminophenyl)-(4-fluorophenyl)methanone (CAS 10055-40-0) is a chemical compound with the molecular formula C13H10FNO and a molecular weight of 215.22 g/mol. IUPAC name: (4-aminophenyl)-(4-fluorophenyl)methanone. InChIKey: JHRKKHFDXTWUJO-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO |
|---|---|
| Molecular weight | 215.22 g/mol |
| IUPAC name | (4-aminophenyl)-(4-fluorophenyl)methanone |
| InChIKey | JHRKKHFDXTWUJO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)F)N |
Computed by PubChem (NCBI)