CAS 1629-09-0 appears in our catalog under these names: N-Phenyl 3-fluorobenzamide, 98%, 3-Fluoro-N-phenylbenzamide 98%, N-Phenyl 3-fluorobenzamide, 98%, 98%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 100g, 25g, 5g.
3-fluoro-N-phenylbenzamide (CAS 1629-09-0) is a chemical compound with the molecular formula C13H10FNO and a molecular weight of 215.22 g/mol. IUPAC name: 3-fluoro-N-phenylbenzamide. InChIKey: STGITJSNRGHAQZ-UHFFFAOYSA-N.
| Molecular formula | C13H10FNO |
|---|---|
| Molecular weight | 215.22 g/mol |
| IUPAC name | 3-fluoro-N-phenylbenzamide |
| InChIKey | STGITJSNRGHAQZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)