cas: 1214376-83-6 — see every product listed under this CAS number, including other names
(2-Bromo-3-fluorophenyl)methanamine hydrochloride, 97% (CAS 1214376-83-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F460367-100MG |
| cas | 1214376-83-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 383.22 Pln | |
| Fluorochem | 250mg | 560.24 Pln | |
| Fluorochem | 1g | 1388.07 Pln | |
| Fluorochem | 5g | 6719.53 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2-bromo-3-fluorophenyl)methanamine;hydrochloride (CAS 1214376-83-6) is a chemical compound with the molecular formula C7H8BrClFN and a molecular weight of 240.50 g/mol. IUPAC name: (2-bromo-3-fluorophenyl)methanamine;hydrochloride. InChIKey: VMJIHHQKBDPPES-UHFFFAOYSA-N.
| Molecular formula | C7H8BrClFN |
|---|---|
| Molecular weight | 240.50 g/mol |
| IUPAC name | (2-bromo-3-fluorophenyl)methanamine;hydrochloride |
| InChIKey | VMJIHHQKBDPPES-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)Br)CN.Cl |
Computed by PubChem (NCBI)