CAS 1214330-90-1 appears in our catalog under these names: Benzenemethanamine, 2-bromo-6-fluoro-, hydrochloride (1:1), 98%, 98%, 2-Bromo-6-fluorobenzylamine hydrochloride, 95%, (2-Bromo-6-fluorophenyl)methanamine hydrochloride, 98+%, 2-Bromo-6-fluorobenzylamine hydrochloride, 96% , 2-BROMO-6-FLUOROBENZYLAMINE HCL, 98%. Offered by: Chemat, Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
(2-bromo-6-fluorophenyl)methanamine;hydrochloride (CAS 1214330-90-1) is a chemical compound with the molecular formula C7H8BrClFN and a molecular weight of 240.50 g/mol. IUPAC name: (2-bromo-6-fluorophenyl)methanamine;hydrochloride. InChIKey: WEGQVRTUTQKDNY-UHFFFAOYSA-N.
| Molecular formula | C7H8BrClFN |
|---|---|
| Molecular weight | 240.50 g/mol |
| IUPAC name | (2-bromo-6-fluorophenyl)methanamine;hydrochloride |
| InChIKey | WEGQVRTUTQKDNY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)CN)F.Cl |
Computed by PubChem (NCBI)