CAS 1177559-63-5 appears in our catalog under these names: (3-Bromo-2-fluorophenyl)methanamine hydrochloride, 95%, (3–Bromo–2–fluorophenyl)methanamine hydrochloride, (3-Bromo-2-fluorophenyl)methanamine HCl 95%, (3-Bromo-2-fluorophenyl)methanamine hydrochloride, 95%, 95%, (3-Bromo-2-fluorophenyl)methanamine hydrochloride, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 25g, 10g, 1g, 100mg.
(3-bromo-2-fluorophenyl)methanamine;hydrochloride (CAS 1177559-63-5) is a chemical compound with the molecular formula C7H8BrClFN and a molecular weight of 240.50 g/mol. IUPAC name: (3-bromo-2-fluorophenyl)methanamine;hydrochloride. InChIKey: UESRHZRMSFJHEY-UHFFFAOYSA-N.
| Molecular formula | C7H8BrClFN |
|---|---|
| Molecular weight | 240.50 g/mol |
| IUPAC name | (3-bromo-2-fluorophenyl)methanamine;hydrochloride |
| InChIKey | UESRHZRMSFJHEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)F)CN.Cl |
Computed by PubChem (NCBI)