cas: 54370-00-2 — see every product listed under this CAS number, including other names
(2-Bromo-4,5-dimethoxyphenyl)methanol, 98%, 98% (CAS 54370-00-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11D8YE-100mg |
| cas | 54370-00-2 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 299.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2-bromo-4,5-dimethoxyphenyl)methanol (CAS 54370-00-2) is a chemical compound with the molecular formula C9H11BrO3 and a molecular weight of 247.09 g/mol. IUPAC name: (2-bromo-4,5-dimethoxyphenyl)methanol. InChIKey: SDZSRNYOXRHPHZ-UHFFFAOYSA-N.
| Molecular formula | C9H11BrO3 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | (2-bromo-4,5-dimethoxyphenyl)methanol |
| InChIKey | SDZSRNYOXRHPHZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CO)Br)OC |
Computed by PubChem (NCBI)