cas: 54370-00-2 — see every product listed under this CAS number, including other names
Pinaverium impurity 1, 99.96% (CAS 54370-00-2) is a chemical reagent available from Chemat. Available pack sizes: 500 mg, 1 g, 250 mg, 100 mg, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W137686-500 mg |
| cas | 54370-00-2 |
| size | 500 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 500 mg | 514.74 Pln | |
| MedChemExpress | 1 g | 765.52 Pln | |
| MedChemExpress | 250 mg | 361.49 Pln | |
| MedChemExpress | 100 mg | 240.74 Pln | |
| MedChemExpress | 5 g | 2061.19 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.96% |
(2-bromo-4,5-dimethoxyphenyl)methanol (CAS 54370-00-2) is a chemical compound with the molecular formula C9H11BrO3 and a molecular weight of 247.09 g/mol. IUPAC name: (2-bromo-4,5-dimethoxyphenyl)methanol. InChIKey: SDZSRNYOXRHPHZ-UHFFFAOYSA-N.
| Molecular formula | C9H11BrO3 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | (2-bromo-4,5-dimethoxyphenyl)methanol |
| InChIKey | SDZSRNYOXRHPHZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CO)Br)OC |
Computed by PubChem (NCBI)