cas: 54370-00-2 — see every product listed under this CAS number, including other names
2-Bromo-4,5-dimethoxybenzyl alcohol, 98% (CAS 54370-00-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 342210050 |
| cas | 54370-00-2 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 113.59 Pln | |
| Thermo Scientific (Acros) | 25g | 380.86 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
(2-bromo-4,5-dimethoxyphenyl)methanol (CAS 54370-00-2) is a chemical compound with the molecular formula C9H11BrO3 and a molecular weight of 247.09 g/mol. IUPAC name: (2-bromo-4,5-dimethoxyphenyl)methanol. InChIKey: SDZSRNYOXRHPHZ-UHFFFAOYSA-N.
| Molecular formula | C9H11BrO3 |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | (2-bromo-4,5-dimethoxyphenyl)methanol |
| InChIKey | SDZSRNYOXRHPHZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CO)Br)OC |
Computed by PubChem (NCBI)