cas: 1309980-97-9 — see every product listed under this CAS number, including other names
(2-Bromo-6-chloro-3-methylphenyl)boronic acid 95+% (CAS 1309980-97-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A899910-250mg |
| cas | 1309980-97-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 698.56 Pln | |
| Ambeed | 5g | 2350.62 Pln | |
| Ambeed | 10g | 3969.31 Pln | |
| Ambeed | 25g | 7740.69 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A899910 |
(2-bromo-6-chloro-3-methylphenyl)boronic acid (CAS 1309980-97-9) is a chemical compound with the molecular formula C7H7BBrClO2 and a molecular weight of 249.30 g/mol. IUPAC name: (2-bromo-6-chloro-3-methylphenyl)boronic acid. InChIKey: FNGFBBSYYMTENN-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrClO2 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | (2-bromo-6-chloro-3-methylphenyl)boronic acid |
| InChIKey | FNGFBBSYYMTENN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1Br)C)Cl)(O)O |
Computed by PubChem (NCBI)