Products 2377607-91-3
CAS 2377607-91-3 is the registry number for 4-Bromo-3-chloro-5-methylphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(4-bromo-3-chloro-5-methylphenyl)boronic acid (CAS 2377607-91-3) is a chemical compound with the molecular formula C7H7BBrClO2 and a molecular weight of 249.30 g/mol. IUPAC name: (4-bromo-3-chloro-5-methylphenyl)boronic acid. InChIKey: BIEGCQMVHGSKMI-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrClO2 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | (4-bromo-3-chloro-5-methylphenyl)boronic acid |
| InChIKey | BIEGCQMVHGSKMI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)Br)C)(O)O |
Computed by PubChem (NCBI)