CAS 1451391-48-2 appears in our catalog under these names: 4-Bromo-5-chloro-2-methylphenylboronic acid, 95%, 3–Chloro–4–bromo–6–methylphenylboronic acid, 4-Bromo-5-chloro-2-methylphenylboronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 5g, 10g, 1g, 250mg, 25mg.
(4-bromo-5-chloro-2-methylphenyl)boronic acid (CAS 1451391-48-2) is a chemical compound with the molecular formula C7H7BBrClO2 and a molecular weight of 249.30 g/mol. IUPAC name: (4-bromo-5-chloro-2-methylphenyl)boronic acid. InChIKey: QUSLUGGNEDZERY-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrClO2 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | (4-bromo-5-chloro-2-methylphenyl)boronic acid |
| InChIKey | QUSLUGGNEDZERY-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)Br)Cl)(O)O |
Computed by PubChem (NCBI)