cas: 1315476-03-9 — see every product listed under this CAS number, including other names
(2-Bromo-6-fluoro-4-methoxyphenyl)boronic acid, 98+% (CAS 1315476-03-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A200350-10g |
| cas | 1315476-03-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 7432.81 Pln | |
| AmBeed | 25g | 14541.73 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2-bromo-6-fluoro-4-methoxyphenyl)boronic acid (CAS 1315476-03-9) is a chemical compound with the molecular formula C7H7BBrFO3 and a molecular weight of 248.84 g/mol. IUPAC name: (2-bromo-6-fluoro-4-methoxyphenyl)boronic acid. InChIKey: NORQOWBPWLGVLB-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrFO3 |
|---|---|
| Molecular weight | 248.84 g/mol |
| IUPAC name | (2-bromo-6-fluoro-4-methoxyphenyl)boronic acid |
| InChIKey | NORQOWBPWLGVLB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1Br)OC)F)(O)O |
Computed by PubChem (NCBI)