CAS 957120-30-8 appears in our catalog under these names: (3-Bromo-6-fluoro-2-methoxyphenyl)boronic acid, 97%, 3-Bromo-6-fluoro-2-methoxyphenylboronic acid, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g.
(3-bromo-6-fluoro-2-methoxyphenyl)boronic acid (CAS 957120-30-8) is a chemical compound with the molecular formula C7H7BBrFO3 and a molecular weight of 248.84 g/mol. IUPAC name: (3-bromo-6-fluoro-2-methoxyphenyl)boronic acid. InChIKey: YJEJISGIPNUDBB-UHFFFAOYSA-N.
| Molecular formula | C7H7BBrFO3 |
|---|---|
| Molecular weight | 248.84 g/mol |
| IUPAC name | (3-bromo-6-fluoro-2-methoxyphenyl)boronic acid |
| InChIKey | YJEJISGIPNUDBB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1OC)Br)F)(O)O |
Computed by PubChem (NCBI)