(2-Bromophenyl)(4-fluorophenyl)methanone, 95%
cas: 573-46-6 — see every product listed under this CAS number, including other names
(2-Bromophenyl)(4-fluorophenyl)methanone, 95% (CAS 573-46-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A745216-100mg |
| cas | 573-46-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 1171.38 Pln | |
| Ambeed | 5g | 4469.94 Pln | |
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 1g | 1082.00 Pln | |
| BLDpharm | 100mg | 303.25 Pln | |
| BLDpharm | 250mg | 469.86 Pln | |
| BLDpharm | 1g | 1147.40 Pln | |
| BLDpharm | 5g | 4385.15 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2-bromophenyl)-(4-fluorophenyl)methanone (CAS 573-46-6) is a chemical compound with the molecular formula C13H8BrFO and a molecular weight of 279.10 g/mol. IUPAC name: (2-bromophenyl)-(4-fluorophenyl)methanone. InChIKey: DIDPRFGMOLQJTB-UHFFFAOYSA-N.
| Molecular formula | C13H8BrFO |
|---|---|
| Molecular weight | 279.10 g/mol |
| IUPAC name | (2-bromophenyl)-(4-fluorophenyl)methanone |
| InChIKey | DIDPRFGMOLQJTB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)F)Br |
Computed by PubChem (NCBI)
