Products 46698-24-2
CAS 46698-24-2 appears in our catalog under these names: 3-Bromo-4'-fluorobenzophenone, 98%, 3–Bromo–4′–fluorobenzophenone. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g.
(3-bromophenyl)-(4-fluorophenyl)methanone (CAS 46698-24-2) is a chemical compound with the molecular formula C13H8BrFO and a molecular weight of 279.10 g/mol. IUPAC name: (3-bromophenyl)-(4-fluorophenyl)methanone. InChIKey: QLWGPEHYNFONNA-UHFFFAOYSA-N.
| Molecular formula | C13H8BrFO |
|---|---|
| Molecular weight | 279.10 g/mol |
| IUPAC name | (3-bromophenyl)-(4-fluorophenyl)methanone |
| InChIKey | QLWGPEHYNFONNA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)