Products 75762-58-2
CAS 75762-58-2 is the registry number for (3-Bromophenyl)(3-fluorophenyl)methanone, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3-bromophenyl)-(3-fluorophenyl)methanone (CAS 75762-58-2) is a chemical compound with the molecular formula C13H8BrFO and a molecular weight of 279.10 g/mol. IUPAC name: (3-bromophenyl)-(3-fluorophenyl)methanone. InChIKey: KGAQUGKHKYDPDW-UHFFFAOYSA-N.
| Molecular formula | C13H8BrFO |
|---|---|
| Molecular weight | 279.10 g/mol |
| IUPAC name | (3-bromophenyl)-(3-fluorophenyl)methanone |
| InChIKey | KGAQUGKHKYDPDW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)