cas: 1688698-58-9 — see every product listed under this CAS number, including other names
(2-Chloro-3-fluorophenyl)boronic acid pinacol ester, ≥99%, ≥99% (CAS 1688698-58-9) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12V2LU-1g |
| cas | 1688698-58-9 |
| size | 1g |
| availability | 64g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 645.20 Pln |
| purity | ≥99% |
|---|---|
| delivery time | 3 weeks |
2-(2-chloro-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1688698-58-9) is a chemical compound with the molecular formula C12H15BClFO2 and a molecular weight of 256.51 g/mol. IUPAC name: 2-(2-chloro-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XZKUFCKSUHVAEK-UHFFFAOYSA-N.
| Molecular formula | C12H15BClFO2 |
|---|---|
| Molecular weight | 256.51 g/mol |
| IUPAC name | 2-(2-chloro-3-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XZKUFCKSUHVAEK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)F)Cl |
Computed by PubChem (NCBI)