Products 870486-41-2
CAS 870486-41-2 appears in our catalog under these names: 2-(2-Chloro-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-Chloro-5-fluorobenzeneboronic acid pinacol ester, 99%+(GC-MS),RG, 99%+(GC-MS),RG, 2-Chloro-5-fluorophenylboronic acid pinacol ester, 99%+(GC-MS),RG. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
2-(2-chloro-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 870486-41-2) is a chemical compound with the molecular formula C12H15BClFO2 and a molecular weight of 256.51 g/mol. IUPAC name: 2-(2-chloro-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZDEZMLTVDFZRET-UHFFFAOYSA-N.
| Molecular formula | C12H15BClFO2 |
|---|---|
| Molecular weight | 256.51 g/mol |
| IUPAC name | 2-(2-chloro-5-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZDEZMLTVDFZRET-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)F)Cl |
Computed by PubChem (NCBI)