CAS 892845-64-6 appears in our catalog under these names: 2-Chloro-4-fluorobenzeneboronic acid pinacol ester, 98%, 98%, 2-(2-Chloro-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 500mg, 2.5g, 5g, 10g.
2-(2-chloro-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 892845-64-6) is a chemical compound with the molecular formula C12H15BClFO2 and a molecular weight of 256.51 g/mol. IUPAC name: 2-(2-chloro-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZHPGAWQGOLXMRK-UHFFFAOYSA-N.
| Molecular formula | C12H15BClFO2 |
|---|---|
| Molecular weight | 256.51 g/mol |
| IUPAC name | 2-(2-chloro-4-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZHPGAWQGOLXMRK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)F)Cl |
Computed by PubChem (NCBI)