cas: 1451392-01-0 — see every product listed under this CAS number, including other names
(2-FLUORO-3-METHOXYPYRIDIN-4-YL)BORONIC ACID, 97% (CAS 1451392-01-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F531599-1G |
| cas | 1451392-01-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3309.27 Pln | |
| Fluorochem | 100mg | 789.32 Pln | |
| Fluorochem | 250mg | 1289.15 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2-fluoro-3-methoxy-4-pyridinyl)boronic acid (CAS 1451392-01-0) is a chemical compound with the molecular formula C6H7BFNO3 and a molecular weight of 170.94 g/mol. IUPAC name: (2-fluoro-3-methoxy-4-pyridinyl)boronic acid. InChIKey: XJHXSDGMVPHYJZ-UHFFFAOYSA-N.
| Molecular formula | C6H7BFNO3 |
|---|---|
| Molecular weight | 170.94 g/mol |
| IUPAC name | (2-fluoro-3-methoxy-4-pyridinyl)boronic acid |
| InChIKey | XJHXSDGMVPHYJZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)F)OC)(O)O |
Computed by PubChem (NCBI)