Products 1598387-84-8
CAS 1598387-84-8 appears in our catalog under these names: (3-Fluoro-2-methoxypyridin-4-yl)boronic acid, 98%, (3-fluoro-2-methoxypyridin-4-yl)boronic acid, (3-Fluoro-2-methoxypyridin-4-yl)boronic acid 98%, (3-Fluoro-2-methoxypyridin-4-yl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg, 500mg.
(3-fluoro-2-methoxy-4-pyridinyl)boronic acid (CAS 1598387-84-8) is a chemical compound with the molecular formula C6H7BFNO3 and a molecular weight of 170.94 g/mol. IUPAC name: (3-fluoro-2-methoxy-4-pyridinyl)boronic acid. InChIKey: GEAQIISIRPULKJ-UHFFFAOYSA-N.
| Molecular formula | C6H7BFNO3 |
|---|---|
| Molecular weight | 170.94 g/mol |
| IUPAC name | (3-fluoro-2-methoxy-4-pyridinyl)boronic acid |
| InChIKey | GEAQIISIRPULKJ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)OC)F)(O)O |
Computed by PubChem (NCBI)