CAS 1451392-07-6 appears in our catalog under these names: 2-Fluoro-3-methoxypyridine-5-boronic acid, 98%, (6-Fluoro-5-methoxypyridin-3-yl)boronic acid, 97%, B-(6-Fluoro-5-methoxy-3-pyridinyl)boronic acid, 95%, 95%, (6-Fluoro-5-methoxypyridin-3-yl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg.
(6-fluoro-5-methoxy-3-pyridinyl)boronic acid (CAS 1451392-07-6) is a chemical compound with the molecular formula C6H7BFNO3 and a molecular weight of 170.94 g/mol. IUPAC name: (6-fluoro-5-methoxy-3-pyridinyl)boronic acid. InChIKey: LOTUGWODSACCQG-UHFFFAOYSA-N.
| Molecular formula | C6H7BFNO3 |
|---|---|
| Molecular weight | 170.94 g/mol |
| IUPAC name | (6-fluoro-5-methoxy-3-pyridinyl)boronic acid |
| InChIKey | LOTUGWODSACCQG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)F)OC)(O)O |
Computed by PubChem (NCBI)