cas: 1072952-25-0 — see every product listed under this CAS number, including other names
(2-Fluoro-5-(hydroxymethyl)phenyl)boronic acid 96% (CAS 1072952-25-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A142781-1g |
| cas | 1072952-25-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 186.81 Pln | |
| Ambeed | 10g | 281.38 Pln | |
| Ambeed | 25g | 542.81 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A142781 |
[2-fluoro-5-(hydroxymethyl)phenyl]boronic acid (CAS 1072952-25-0) is a chemical compound with the molecular formula C7H8BFO3 and a molecular weight of 169.95 g/mol. IUPAC name: [2-fluoro-5-(hydroxymethyl)phenyl]boronic acid. InChIKey: CMJGYVJNQJJJOZ-UHFFFAOYSA-N.
| Molecular formula | C7H8BFO3 |
|---|---|
| Molecular weight | 169.95 g/mol |
| IUPAC name | [2-fluoro-5-(hydroxymethyl)phenyl]boronic acid |
| InChIKey | CMJGYVJNQJJJOZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)CO)F)(O)O |
Computed by PubChem (NCBI)